C18H14F2N2O5S — CID 8861098
2-[(E)-2-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]ethenyl]-5-nitro-1,3-benzothiazole (PubChem CID 8861098) has the molecular formula C18H14F2N2O5S and a molecular weight of 408.38 g/mol. Its IUPAC name is 2-[(E)-2-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]ethenyl]-5-nitro-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]ethenyl]-5-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 8861098 |
| Molecular Formula | C18H14F2N2O5S |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-[(E)-2-[4-(difluoromethoxy)-3,5-dimethoxyphenyl]ethenyl]-5-nitro-1,3-benzothiazole |
| SMILES | COc1cc(/C=C/c2nc3cc([N+](=O)[O-])ccc3s2)cc(OC)c1OC(F)F |
| InChI | InChI=1S/C18H14F2N2O5S/c1-25-13-7-10(8-14(26-2)17(13)27-18(19)20)3-6-16-21-12-9-11(22(23)24)4-5-15(12)28-16/h3-9,18H,1-2H3/b6-3+ |
| InChIKey | POASJAXOAQBGGD-ZZXKWVIFSA-N |
| XLogP | 4.99 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|