C15H8BrN3O4S — CID 8860944
2-[(E)-2-(4-bromo-3-nitrophenyl)ethenyl]-5-nitro-1,3-benzothiazole (PubChem CID 8860944) has the molecular formula C15H8BrN3O4S and a molecular weight of 406.22 g/mol. Its IUPAC name is 2-[(E)-2-(4-bromo-3-nitrophenyl)ethenyl]-5-nitro-1,3-benzothiazole.
| Compound Name | 2-[(E)-2-(4-bromo-3-nitrophenyl)ethenyl]-5-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 8860944 |
| Molecular Formula | C15H8BrN3O4S |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 404.94 |
| IUPAC Name | 2-[(E)-2-(4-bromo-3-nitrophenyl)ethenyl]-5-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2sc(/C=C/c3ccc(Br)c([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C15H8BrN3O4S/c16-11-4-1-9(7-13(11)19(22)23)2-6-15-17-12-8-10(18(20)21)3-5-14(12)24-15/h1-8H/b6-2+ |
| InChIKey | XAAQKIKWODHWMK-QHHAFSJGSA-N |
| XLogP | 5.05 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|