C16H23NO6 — CID 11370772
(2S)-3-prop-2-enoxy-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoic acid (PubChem CID 11370772) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is (2S)-3-prop-2-enoxy-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoic acid.
| Compound Name | (2S)-3-prop-2-enoxy-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 11370772 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (2S)-3-prop-2-enoxy-2-[(2,4,6-trimethoxyphenyl)methylamino]propanoic acid |
| SMILES | C=CCOC[C@H](NCc1c(OC)cc(OC)cc1OC)C(=O)O |
| InChI | InChI=1S/C16H23NO6/c1-5-6-23-10-13(16(18)19)17-9-12-14(21-3)7-11(20-2)8-15(12)22-4/h5,7-8,13,17H,1,6,9-10H2,2-4H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | WHTPMAZWHUENBV-ZDUSSCGKSA-N |
| XLogP | 1.46 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|