C13H20O2 — CID 11769782
1,3-dimethoxy-5-(5,5,5-trideuteriopentyl)benzene (PubChem CID 11769782) has the molecular formula C13H20O2 and a molecular weight of 211.32 g/mol. Its IUPAC name is 1,3-dimethoxy-5-(5,5,5-trideuteriopentyl)benzene.
| Compound Name | 1,3-dimethoxy-5-(5,5,5-trideuteriopentyl)benzene |
|---|---|
| PubChem CID | 11769782 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1,3-dimethoxy-5-(5,5,5-trideuteriopentyl)benzene |
| SMILES | [2H]C([2H])([2H])CCCCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C13H20O2/c1-4-5-6-7-11-8-12(14-2)10-13(9-11)15-3/h8-10H,4-7H2,1-3H3/i1D3 |
| InChIKey | LSPSEUBXQFHRGA-FIBGUPNXSA-N |
| XLogP | 3.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|