C24H36O4 — CID 162222442
1,3-dimethoxy-5-pentylbenzene;5-pentylbenzene-1,3-diol (PubChem CID 162222442) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 1,3-dimethoxy-5-pentylbenzene;5-pentylbenzene-1,3-diol.
| Compound Name | 1,3-dimethoxy-5-pentylbenzene;5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 162222442 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 1,3-dimethoxy-5-pentylbenzene;5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)cc(O)c1.CCCCCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C13H20O2.C11H16O2/c1-4-5-6-7-11-8-12(14-2)10-13(9-11)15-3;1-2-3-4-5-9-6-10(12)8-11(13)7-9/h8-10H,4-7H2,1-3H3;6-8,12-13H,2-5H2,1H3 |
| InChIKey | ZUHPKRUXLCDJGS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|