About 3-ethyl-5-pentylphenol
3-ethyl-5-pentylphenol (PubChem CID 130224031) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 3-ethyl-5-pentylphenol.
Molecular Properties
| Compound Name | 3-ethyl-5-pentylphenol |
| PubChem CID | 130224031 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 3-ethyl-5-pentylphenol |
| SMILES | CCCCCc1cc(O)cc(CC)c1 |
| InChI | InChI=1S/C13H20O/c1-3-5-6-7-12-8-11(4-2)9-13(14)10-12/h8-10,14H,3-7H2,1-2H3 |
| InChIKey | KJZAOPRSRYYJCH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-5-pentylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-pentylphenol?
The IUPAC name of 3-ethyl-5-pentylphenol (CID 130224031) is 3-ethyl-5-pentylphenol.
What is the SMILES notation for 3-ethyl-5-pentylphenol?
The canonical SMILES for 3-ethyl-5-pentylphenol is CCCCCc1cc(O)cc(CC)c1.
What is the InChIKey of 3-ethyl-5-pentylphenol?
The InChIKey is KJZAOPRSRYYJCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-3-5-6-7-12-8-11(4-2)9-13(14)10-12/h8-10,14H,3-7H2,1-2H3.
What are the key properties of 3-ethyl-5-pentylphenol?
3-ethyl-5-pentylphenol has a molecular weight of 192.30 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-pentylphenol is sourced from PubChem (CID 130224031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).