C11H16O2 — CID 11286856
5-(5,5,5-trideuteriopentyl)benzene-1,3-diol (PubChem CID 11286856) has the molecular formula C11H16O2 and a molecular weight of 183.27 g/mol. Its IUPAC name is 5-(5,5,5-trideuteriopentyl)benzene-1,3-diol.
| Compound Name | 5-(5,5,5-trideuteriopentyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 11286856 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 5-(5,5,5-trideuteriopentyl)benzene-1,3-diol |
| SMILES | [2H]C([2H])([2H])CCCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H16O2/c1-2-3-4-5-9-6-10(12)8-11(13)7-9/h6-8,12-13H,2-5H2,1H3/i1D3 |
| InChIKey | IRMPFYJSHJGOPE-FIBGUPNXSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|