C16H21F4NO2 — CID 150176486
2-amino-4-ethyl-2-methyl-7-(2,3,4,5-tetrafluorophenyl)heptanoic acid (PubChem CID 150176486) has the molecular formula C16H21F4NO2 and a molecular weight of 335.34 g/mol. Its IUPAC name is 2-amino-4-ethyl-2-methyl-7-(2,3,4,5-tetrafluorophenyl)heptanoic acid.
| Compound Name | 2-amino-4-ethyl-2-methyl-7-(2,3,4,5-tetrafluorophenyl)heptanoic acid |
|---|---|
| PubChem CID | 150176486 |
| Molecular Formula | C16H21F4NO2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-amino-4-ethyl-2-methyl-7-(2,3,4,5-tetrafluorophenyl)heptanoic acid |
| SMILES | CCC(CCCc1cc(F)c(F)c(F)c1F)CC(C)(N)C(=O)O |
| InChI | InChI=1S/C16H21F4NO2/c1-3-9(8-16(2,21)15(22)23)5-4-6-10-7-11(17)13(19)14(20)12(10)18/h7,9H,3-6,8,21H2,1-2H3,(H,22,23) |
| InChIKey | FKNGWBADWJCLAA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|