2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid

C17H27NO4 — CID 151267584

IUPAC2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid
SMILESCCOc1cccc(OCC)c1CC(C)CC(C)(N)C(=O)O
InChIInChI=1S/C17H27NO4/c1-5-21-14-8-7-9-15(22-6-2)13(14)10-12(3)11-17(4,18)16(19)20/h7-9,12H,5-6,10-11,18H2,1-4H3,(H,19,20)
InChIKeyNVRBMQBXDYYPLY-UHFFFAOYSA-N
MW309.41 g/mol
LogP2.85
Rot. Bonds9

About 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid

2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid (PubChem CID 151267584) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid.

Molecular Properties

Compound Name2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid
PubChem CID151267584
Molecular FormulaC17H27NO4
Molecular Weight309.41 g/mol
Exact Mass309.19
IUPAC Name2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid
SMILESCCOc1cccc(OCC)c1CC(C)CC(C)(N)C(=O)O
InChIInChI=1S/C17H27NO4/c1-5-21-14-8-7-9-15(22-6-2)13(14)10-12(3)11-17(4,18)16(19)20/h7-9,12H,5-6,10-11,18H2,1-4H3,(H,19,20)
InChIKeyNVRBMQBXDYYPLY-UHFFFAOYSA-N
XLogP2.85
TPSA81.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.41
LogP ≤ 52.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid?
The IUPAC name of 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid (CID 151267584) is 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid.
What is the SMILES notation for 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid?
The canonical SMILES for 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid is CCOc1cccc(OCC)c1CC(C)CC(C)(N)C(=O)O.
What is the InChIKey of 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid?
The InChIKey is NVRBMQBXDYYPLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO4/c1-5-21-14-8-7-9-15(22-6-2)13(14)10-12(3)11-17(4,18)16(19)20/h7-9,12H,5-6,10-11,18H2,1-4H3,(H,19,20).
What are the key properties of 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid?
2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid has a molecular weight of 309.41 g/mol, XLogP of 2.85, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid is sourced from PubChem (CID 151267584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).