C17H27NO4 — CID 151267584
2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid (PubChem CID 151267584) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid.
| Compound Name | 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 151267584 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-amino-5-(2,6-diethoxyphenyl)-2,4-dimethylpentanoic acid |
| SMILES | CCOc1cccc(OCC)c1CC(C)CC(C)(N)C(=O)O |
| InChI | InChI=1S/C17H27NO4/c1-5-21-14-8-7-9-15(22-6-2)13(14)10-12(3)11-17(4,18)16(19)20/h7-9,12H,5-6,10-11,18H2,1-4H3,(H,19,20) |
| InChIKey | NVRBMQBXDYYPLY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |