C13H19NO3 — CID 151689905
2-amino-5-(4-hydroxyphenyl)-2,4-dimethylpentanoic acid (PubChem CID 151689905) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-amino-5-(4-hydroxyphenyl)-2,4-dimethylpentanoic acid.
| Compound Name | 2-amino-5-(4-hydroxyphenyl)-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 151689905 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-amino-5-(4-hydroxyphenyl)-2,4-dimethylpentanoic acid |
| SMILES | CC(Cc1ccc(O)cc1)CC(C)(N)C(=O)O |
| InChI | InChI=1S/C13H19NO3/c1-9(8-13(2,14)12(16)17)7-10-3-5-11(15)6-4-10/h3-6,9,15H,7-8,14H2,1-2H3,(H,16,17) |
| InChIKey | RCILYXVXPYKLQY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |