C17H21NO2 — CID 67671985
4-[(1R,3R)-1-amino-1-hydroxy-3-methyl-4-phenylbutyl]phenol (PubChem CID 67671985) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[(1R,3R)-1-amino-1-hydroxy-3-methyl-4-phenylbutyl]phenol.
| Compound Name | 4-[(1R,3R)-1-amino-1-hydroxy-3-methyl-4-phenylbutyl]phenol |
|---|---|
| PubChem CID | 67671985 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 4-[(1R,3R)-1-amino-1-hydroxy-3-methyl-4-phenylbutyl]phenol |
| SMILES | C[C@H](Cc1ccccc1)C[C@@](N)(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H21NO2/c1-13(11-14-5-3-2-4-6-14)12-17(18,20)15-7-9-16(19)10-8-15/h2-10,13,19-20H,11-12,18H2,1H3/t13-,17-/m1/s1 |
| InChIKey | FWKLSFOCZQLMMI-CXAGYDPISA-N |
| XLogP | 2.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|