C19H24N2O3 — CID 70021190
5-[(1R,3R)-1-amino-1-hydroxy-3-methyl-5-phenylpentyl]-2-hydroxybenzamide (PubChem CID 70021190) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 5-[(1R,3R)-1-amino-1-hydroxy-3-methyl-5-phenylpentyl]-2-hydroxybenzamide.
| Compound Name | 5-[(1R,3R)-1-amino-1-hydroxy-3-methyl-5-phenylpentyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 70021190 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 5-[(1R,3R)-1-amino-1-hydroxy-3-methyl-5-phenylpentyl]-2-hydroxybenzamide |
| SMILES | C[C@H](CCc1ccccc1)C[C@@](N)(O)c1ccc(O)c(C(N)=O)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-13(7-8-14-5-3-2-4-6-14)12-19(21,24)15-9-10-17(22)16(11-15)18(20)23/h2-6,9-11,13,22,24H,7-8,12,21H2,1H3,(H2,20,23)/t13-,19-/m1/s1 |
| InChIKey | ZKMXTNQLTKRGFF-BFUOFWGJSA-N |
| XLogP | 2.25 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|