C19H31NO4 — CID 69268091
2-(aminomethyl)-7-(2,6-diethoxyphenyl)-4-methylheptanoic acid (PubChem CID 69268091) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is 2-(aminomethyl)-7-(2,6-diethoxyphenyl)-4-methylheptanoic acid.
| Compound Name | 2-(aminomethyl)-7-(2,6-diethoxyphenyl)-4-methylheptanoic acid |
|---|---|
| PubChem CID | 69268091 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 2-(aminomethyl)-7-(2,6-diethoxyphenyl)-4-methylheptanoic acid |
| SMILES | CCOc1cccc(OCC)c1CCCC(C)CC(CN)C(=O)O |
| InChI | InChI=1S/C19H31NO4/c1-4-23-17-10-7-11-18(24-5-2)16(17)9-6-8-14(3)12-15(13-20)19(21)22/h7,10-11,14-15H,4-6,8-9,12-13,20H2,1-3H3,(H,21,22) |
| InChIKey | GGVGAEVVKIDUOR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |