C15H23NO5 — CID 87760157
2-(aminomethyl)-4-methyl-7-(2,3,6-trihydroxyphenyl)heptanoic acid (PubChem CID 87760157) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-(aminomethyl)-4-methyl-7-(2,3,6-trihydroxyphenyl)heptanoic acid.
| Compound Name | 2-(aminomethyl)-4-methyl-7-(2,3,6-trihydroxyphenyl)heptanoic acid |
|---|---|
| PubChem CID | 87760157 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-(aminomethyl)-4-methyl-7-(2,3,6-trihydroxyphenyl)heptanoic acid |
| SMILES | CC(CCCc1c(O)ccc(O)c1O)CC(CN)C(=O)O |
| InChI | InChI=1S/C15H23NO5/c1-9(7-10(8-16)15(20)21)3-2-4-11-12(17)5-6-13(18)14(11)19/h5-6,9-10,17-19H,2-4,7-8,16H2,1H3,(H,20,21) |
| InChIKey | NFSZNXWVUQJXDQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|