C13H19NO5 — CID 87760629
2-(aminomethyl)-4-methyl-5-(2,3,4-trihydroxyphenyl)pentanoic acid (PubChem CID 87760629) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(aminomethyl)-4-methyl-5-(2,3,4-trihydroxyphenyl)pentanoic acid.
| Compound Name | 2-(aminomethyl)-4-methyl-5-(2,3,4-trihydroxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 87760629 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-(aminomethyl)-4-methyl-5-(2,3,4-trihydroxyphenyl)pentanoic acid |
| SMILES | CC(Cc1ccc(O)c(O)c1O)CC(CN)C(=O)O |
| InChI | InChI=1S/C13H19NO5/c1-7(5-9(6-14)13(18)19)4-8-2-3-10(15)12(17)11(8)16/h2-3,7,9,15-17H,4-6,14H2,1H3,(H,18,19) |
| InChIKey | ZKCUAXQIVHSLFA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|