C18H29Br — CID 65427966
2-(2-bromodecyl)-1,4-dimethylbenzene (PubChem CID 65427966) has the molecular formula C18H29Br and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-(2-bromodecyl)-1,4-dimethylbenzene.
| Compound Name | 2-(2-bromodecyl)-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 65427966 |
| Molecular Formula | C18H29Br |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-(2-bromodecyl)-1,4-dimethylbenzene |
| SMILES | CCCCCCCCC(Br)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C18H29Br/c1-4-5-6-7-8-9-10-18(19)14-17-13-15(2)11-12-16(17)3/h11-13,18H,4-10,14H2,1-3H3 |
| InChIKey | SXOXSILOPSIBHR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|