C13H19ClO3 — CID 106866435
3-(2-chloro-4-methylphenyl)-1,1-dimethoxy-2-methylpropan-2-ol (PubChem CID 106866435) has the molecular formula C13H19ClO3 and a molecular weight of 258.74 g/mol. Its IUPAC name is 3-(2-chloro-4-methylphenyl)-1,1-dimethoxy-2-methylpropan-2-ol.
| Compound Name | 3-(2-chloro-4-methylphenyl)-1,1-dimethoxy-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 106866435 |
| Molecular Formula | C13H19ClO3 |
| Molecular Weight | 258.74 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-(2-chloro-4-methylphenyl)-1,1-dimethoxy-2-methylpropan-2-ol |
| SMILES | COC(OC)C(C)(O)Cc1ccc(C)cc1Cl |
| InChI | InChI=1S/C13H19ClO3/c1-9-5-6-10(11(14)7-9)8-13(2,15)12(16-3)17-4/h5-7,12,15H,8H2,1-4H3 |
| InChIKey | YRKABCWJHVNHIH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|