C18H21ClO — CID 106866548
1-(2-chloro-4-methylphenyl)-2-(3,5-dimethylphenyl)propan-2-ol (PubChem CID 106866548) has the molecular formula C18H21ClO and a molecular weight of 288.82 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-2-(3,5-dimethylphenyl)propan-2-ol.
| Compound Name | 1-(2-chloro-4-methylphenyl)-2-(3,5-dimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 106866548 |
| Molecular Formula | C18H21ClO |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-2-(3,5-dimethylphenyl)propan-2-ol |
| SMILES | Cc1cc(C)cc(C(C)(O)Cc2ccc(C)cc2Cl)c1 |
| InChI | InChI=1S/C18H21ClO/c1-12-5-6-15(17(19)10-12)11-18(4,20)16-8-13(2)7-14(3)9-16/h5-10,20H,11H2,1-4H3 |
| InChIKey | KIYRBZKRPZGEDN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |