C10H10F3N5O — CID 107065711
2-(2-methyltetrazol-5-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol (PubChem CID 107065711) has the molecular formula C10H10F3N5O and a molecular weight of 273.22 g/mol. Its IUPAC name is 2-(2-methyltetrazol-5-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol.
| Compound Name | 2-(2-methyltetrazol-5-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 107065711 |
| Molecular Formula | C10H10F3N5O |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(2-methyltetrazol-5-yl)-1-[5-(trifluoromethyl)-2-pyridinyl]ethanol |
| SMILES | Cn1nnc(CC(O)c2ccc(C(F)(F)F)cn2)n1 |
| InChI | InChI=1S/C10H10F3N5O/c1-18-16-9(15-17-18)4-8(19)7-3-2-6(5-14-7)10(11,12)13/h2-3,5,8,19H,4H2,1H3 |
| InChIKey | SVDBWMLLOAKVOC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |