C9H11FN6 — CID 107050206
1-(5-fluoro-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethanamine (PubChem CID 107050206) has the molecular formula C9H11FN6 and a molecular weight of 222.23 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethanamine.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 107050206 |
| Molecular Formula | C9H11FN6 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethanamine |
| SMILES | Cn1nnc(CC(N)c2ccc(F)cn2)n1 |
| InChI | InChI=1S/C9H11FN6/c1-16-14-9(13-15-16)4-7(11)8-3-2-6(10)5-12-8/h2-3,5,7H,4,11H2,1H3 |
| InChIKey | VNVKVPOOICNGSY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |