C10H12ClN5 — CID 107048349
1-(4-chlorophenyl)-2-(2-methyltetrazol-5-yl)ethanamine (PubChem CID 107048349) has the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2-methyltetrazol-5-yl)ethanamine.
| Compound Name | 1-(4-chlorophenyl)-2-(2-methyltetrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 107048349 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2-methyltetrazol-5-yl)ethanamine |
| SMILES | Cn1nnc(CC(N)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C10H12ClN5/c1-16-14-10(13-15-16)6-9(12)7-2-4-8(11)5-3-7/h2-5,9H,6,12H2,1H3 |
| InChIKey | HNKSOMMGPHZPDN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |