C10H14N6 — CID 107051303
1-(4-methyl-3-pyridinyl)-2-(2-methyltetrazol-5-yl)ethanamine (PubChem CID 107051303) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-(4-methyl-3-pyridinyl)-2-(2-methyltetrazol-5-yl)ethanamine.
| Compound Name | 1-(4-methyl-3-pyridinyl)-2-(2-methyltetrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 107051303 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(4-methyl-3-pyridinyl)-2-(2-methyltetrazol-5-yl)ethanamine |
| SMILES | Cc1ccncc1C(N)Cc1nnn(C)n1 |
| InChI | InChI=1S/C10H14N6/c1-7-3-4-12-6-8(7)9(11)5-10-13-15-16(2)14-10/h3-4,6,9H,5,11H2,1-2H3 |
| InChIKey | ZDOKUUQCXRBFSL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |