C13H18ClN5 — CID 107052955
2-[(4-chlorophenyl)methyl]-N-methyl-3-(2-methyltetrazol-5-yl)propan-1-amine (PubChem CID 107052955) has the molecular formula C13H18ClN5 and a molecular weight of 279.78 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-N-methyl-3-(2-methyltetrazol-5-yl)propan-1-amine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-N-methyl-3-(2-methyltetrazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 107052955 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.78 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-N-methyl-3-(2-methyltetrazol-5-yl)propan-1-amine |
| SMILES | CNCC(Cc1ccc(Cl)cc1)Cc1nnn(C)n1 |
| InChI | InChI=1S/C13H18ClN5/c1-15-9-11(8-13-16-18-19(2)17-13)7-10-3-5-12(14)6-4-10/h3-6,11,15H,7-9H2,1-2H3 |
| InChIKey | VQPXEQGJABTMFT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.78 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |