C14H20BrN5 — CID 107052967
2-[(4-bromophenyl)methyl]-N-ethyl-3-(2-methyltetrazol-5-yl)propan-1-amine (PubChem CID 107052967) has the molecular formula C14H20BrN5 and a molecular weight of 338.25 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-N-ethyl-3-(2-methyltetrazol-5-yl)propan-1-amine.
| Compound Name | 2-[(4-bromophenyl)methyl]-N-ethyl-3-(2-methyltetrazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 107052967 |
| Molecular Formula | C14H20BrN5 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-N-ethyl-3-(2-methyltetrazol-5-yl)propan-1-amine |
| SMILES | CCNCC(Cc1ccc(Br)cc1)Cc1nnn(C)n1 |
| InChI | InChI=1S/C14H20BrN5/c1-3-16-10-12(9-14-17-19-20(2)18-14)8-11-4-6-13(15)7-5-11/h4-7,12,16H,3,8-10H2,1-2H3 |
| InChIKey | JJRGDWCIBYZILD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |