C16H14BrF3O — CID 81476241
1-(3-bromo-4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethanol (PubChem CID 81476241) has the molecular formula C16H14BrF3O and a molecular weight of 359.19 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 1-(3-bromo-4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 81476241 |
| Molecular Formula | C16H14BrF3O |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]ethanol |
| SMILES | Cc1ccc(C(O)Cc2ccc(C(F)(F)F)cc2)cc1Br |
| InChI | InChI=1S/C16H14BrF3O/c1-10-2-5-12(9-14(10)17)15(21)8-11-3-6-13(7-4-11)16(18,19)20/h2-7,9,15,21H,8H2,1H3 |
| InChIKey | QQOFDKPWYWNHOU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |