C14H13F3OS — CID 102842312
1-(2-methylthiophen-3-yl)-2-[4-(trifluoromethyl)phenyl]ethanol (PubChem CID 102842312) has the molecular formula C14H13F3OS and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-(2-methylthiophen-3-yl)-2-[4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 1-(2-methylthiophen-3-yl)-2-[4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 102842312 |
| Molecular Formula | C14H13F3OS |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-(2-methylthiophen-3-yl)-2-[4-(trifluoromethyl)phenyl]ethanol |
| SMILES | Cc1sccc1C(O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3OS/c1-9-12(6-7-19-9)13(18)8-10-2-4-11(5-3-10)14(15,16)17/h2-7,13,18H,8H2,1H3 |
| InChIKey | KMQMKJAGSCWTTL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |