C15H14BrFO — CID 114346812
1-(2-bromophenyl)-2-(4-fluoro-2-methylphenyl)ethanol (PubChem CID 114346812) has the molecular formula C15H14BrFO and a molecular weight of 309.18 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2-(4-fluoro-2-methylphenyl)ethanol.
| Compound Name | 1-(2-bromophenyl)-2-(4-fluoro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 114346812 |
| Molecular Formula | C15H14BrFO |
| Molecular Weight | 309.18 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1-(2-bromophenyl)-2-(4-fluoro-2-methylphenyl)ethanol |
| SMILES | Cc1cc(F)ccc1CC(O)c1ccccc1Br |
| InChI | InChI=1S/C15H14BrFO/c1-10-8-12(17)7-6-11(10)9-15(18)13-4-2-3-5-14(13)16/h2-8,15,18H,9H2,1H3 |
| InChIKey | LYKDAJXAGYFGHP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.18 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |