C12H12Br2N2O — CID 107947322
1-(2,4-dibromophenyl)-2-(1-methylpyrazol-4-yl)ethanol (PubChem CID 107947322) has the molecular formula C12H12Br2N2O and a molecular weight of 360.05 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-2-(1-methylpyrazol-4-yl)ethanol.
| Compound Name | 1-(2,4-dibromophenyl)-2-(1-methylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 107947322 |
| Molecular Formula | C12H12Br2N2O |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | 1-(2,4-dibromophenyl)-2-(1-methylpyrazol-4-yl)ethanol |
| SMILES | Cn1cc(CC(O)c2ccc(Br)cc2Br)cn1 |
| InChI | InChI=1S/C12H12Br2N2O/c1-16-7-8(6-15-16)4-12(17)10-3-2-9(13)5-11(10)14/h2-3,5-7,12,17H,4H2,1H3 |
| InChIKey | QKSWHAZZNPEUMD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |