C11H11Br2N3O — CID 107947585
1-(2,4-dibromophenyl)-2-(2-methyl-1,2,4-triazol-3-yl)ethanol (PubChem CID 107947585) has the molecular formula C11H11Br2N3O and a molecular weight of 361.04 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-2-(2-methyl-1,2,4-triazol-3-yl)ethanol.
| Compound Name | 1-(2,4-dibromophenyl)-2-(2-methyl-1,2,4-triazol-3-yl)ethanol |
|---|---|
| PubChem CID | 107947585 |
| Molecular Formula | C11H11Br2N3O |
| Molecular Weight | 361.04 g/mol |
| Exact Mass | 358.93 |
| IUPAC Name | 1-(2,4-dibromophenyl)-2-(2-methyl-1,2,4-triazol-3-yl)ethanol |
| SMILES | Cn1ncnc1CC(O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H11Br2N3O/c1-16-11(14-6-15-16)5-10(17)8-3-2-7(12)4-9(8)13/h2-4,6,10,17H,5H2,1H3 |
| InChIKey | QVIDXWJSDVONRO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.04 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |