C14H14N4O — CID 105107161
2-(2-methyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanol (PubChem CID 105107161) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(2-methyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanol.
| Compound Name | 2-(2-methyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanol |
|---|---|
| PubChem CID | 105107161 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(2-methyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanol |
| SMILES | Cn1ncnc1CC(O)c1cccc2ncccc12 |
| InChI | InChI=1S/C14H14N4O/c1-18-14(16-9-17-18)8-13(19)11-4-2-6-12-10(11)5-3-7-15-12/h2-7,9,13,19H,8H2,1H3 |
| InChIKey | ISTUHZOTOWBSHK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |