C14H15N5O — CID 105109150
2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanol (PubChem CID 105109150) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanol.
| Compound Name | 2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanol |
|---|---|
| PubChem CID | 105109150 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanol |
| SMILES | CCn1ncnc1CC(O)c1cccc2nccnc12 |
| InChI | InChI=1S/C14H15N5O/c1-2-19-13(17-9-18-19)8-12(20)10-4-3-5-11-14(10)16-7-6-15-11/h3-7,9,12,20H,2,8H2,1H3 |
| InChIKey | KSAZNGUNHJLELO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |