C15H15N5O — CID 105112201
2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone (PubChem CID 105112201) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone.
| Compound Name | 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone |
|---|---|
| PubChem CID | 105112201 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone |
| SMILES | CCCn1ncnc1CC(=O)c1cccc2nccnc12 |
| InChI | InChI=1S/C15H15N5O/c1-2-8-20-14(18-10-19-20)9-13(21)11-4-3-5-12-15(11)17-7-6-16-12/h3-7,10H,2,8-9H2,1H3 |
| InChIKey | NFDZEMLVEBQDTI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |