About 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone
2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone (PubChem CID 105112201) has the molecular formula C15H15N5O
and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone.
Molecular Properties
| Compound Name | 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone |
| PubChem CID | 105112201 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone |
| SMILES | CCCn1ncnc1CC(=O)c1cccc2nccnc12 |
| InChI | InChI=1S/C15H15N5O/c1-2-8-20-14(18-10-19-20)9-13(21)11-4-3-5-12-15(11)17-7-6-16-12/h3-7,10H,2,8-9H2,1H3 |
| InChIKey | NFDZEMLVEBQDTI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone?
The IUPAC name of 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone (CID 105112201) is 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone.
What is the SMILES notation for 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone?
The canonical SMILES for 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone is CCCn1ncnc1CC(=O)c1cccc2nccnc12.
What is the InChIKey of 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone?
The InChIKey is NFDZEMLVEBQDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O/c1-2-8-20-14(18-10-19-20)9-13(21)11-4-3-5-12-15(11)17-7-6-16-12/h3-7,10H,2,8-9H2,1H3.
What are the key properties of 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone?
2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone has a molecular weight of 281.32 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-propyl-1,2,4-triazol-3-yl)-1-quinoxalin-5-ylethanone is sourced from PubChem (CID 105112201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).