C15H14N4O — CID 105111478
2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanone (PubChem CID 105111478) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanone.
| Compound Name | 2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanone |
|---|---|
| PubChem CID | 105111478 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanone |
| SMILES | CCn1ncnc1CC(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C15H14N4O/c1-2-19-15(17-10-18-19)9-14(20)12-5-3-7-13-11(12)6-4-8-16-13/h3-8,10H,2,9H2,1H3 |
| InChIKey | ZODNQZXHGSXKNX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |