C15H16N4O — CID 105109180
2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanol (PubChem CID 105109180) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanol.
| Compound Name | 2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanol |
|---|---|
| PubChem CID | 105109180 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-(2-ethyl-1,2,4-triazol-3-yl)-1-quinolin-5-ylethanol |
| SMILES | CCn1ncnc1CC(O)c1cccc2ncccc12 |
| InChI | InChI=1S/C15H16N4O/c1-2-19-15(17-10-18-19)9-14(20)12-5-3-7-13-11(12)6-4-8-16-13/h3-8,10,14,20H,2,9H2,1H3 |
| InChIKey | XMDLHSSSYQABHL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |