C13H12ClF2N3O — CID 115780095
1-(4-chloro-2,5-difluorophenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethanone (PubChem CID 115780095) has the molecular formula C13H12ClF2N3O and a molecular weight of 299.71 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethanone.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethanone |
|---|---|
| PubChem CID | 115780095 |
| Molecular Formula | C13H12ClF2N3O |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethanone |
| SMILES | CCCn1ncnc1CC(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H12ClF2N3O/c1-2-3-19-13(17-7-18-19)6-12(20)8-4-11(16)9(14)5-10(8)15/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | JFCIXCYSNLPKIF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|