C9H11N5O — CID 105107071
2-(2-methyl-1,2,4-triazol-3-yl)-1-pyridazin-4-ylethanol (PubChem CID 105107071) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-(2-methyl-1,2,4-triazol-3-yl)-1-pyridazin-4-ylethanol.
| Compound Name | 2-(2-methyl-1,2,4-triazol-3-yl)-1-pyridazin-4-ylethanol |
|---|---|
| PubChem CID | 105107071 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 2-(2-methyl-1,2,4-triazol-3-yl)-1-pyridazin-4-ylethanol |
| SMILES | Cn1ncnc1CC(O)c1ccnnc1 |
| InChI | InChI=1S/C9H11N5O/c1-14-9(10-6-13-14)4-8(15)7-2-3-11-12-5-7/h2-3,5-6,8,15H,4H2,1H3 |
| InChIKey | QUYINPISRLNQKM-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |