C15H12F5N — CID 62964289
N-[(3,4-difluorophenyl)-(2,3,4-trifluorophenyl)methyl]ethanamine (PubChem CID 62964289) has the molecular formula C15H12F5N and a molecular weight of 301.26 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)-(2,3,4-trifluorophenyl)methyl]ethanamine.
| Compound Name | N-[(3,4-difluorophenyl)-(2,3,4-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 62964289 |
| Molecular Formula | C15H12F5N |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[(3,4-difluorophenyl)-(2,3,4-trifluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H12F5N/c1-2-21-15(8-3-5-10(16)12(18)7-8)9-4-6-11(17)14(20)13(9)19/h3-7,15,21H,2H2,1H3 |
| InChIKey | BQPBFELVXNRTMW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|