C13H12F3N3 — CID 115827042
N-[pyrimidin-5-yl-(2,3,4-trifluorophenyl)methyl]ethanamine (PubChem CID 115827042) has the molecular formula C13H12F3N3 and a molecular weight of 267.25 g/mol. Its IUPAC name is N-[pyrimidin-5-yl-(2,3,4-trifluorophenyl)methyl]ethanamine.
| Compound Name | N-[pyrimidin-5-yl-(2,3,4-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 115827042 |
| Molecular Formula | C13H12F3N3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-[pyrimidin-5-yl-(2,3,4-trifluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cncnc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H12F3N3/c1-2-19-13(8-5-17-7-18-6-8)9-3-4-10(14)12(16)11(9)15/h3-7,13,19H,2H2,1H3 |
| InChIKey | DWYWICWTIFTZJN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|