C15H15F3N2 — CID 62963949
N-[pyridin-4-yl-(2,3,4-trifluorophenyl)methyl]propan-1-amine (PubChem CID 62963949) has the molecular formula C15H15F3N2 and a molecular weight of 280.29 g/mol. Its IUPAC name is N-[pyridin-4-yl-(2,3,4-trifluorophenyl)methyl]propan-1-amine.
| Compound Name | N-[pyridin-4-yl-(2,3,4-trifluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 62963949 |
| Molecular Formula | C15H15F3N2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[pyridin-4-yl-(2,3,4-trifluorophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccncc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H15F3N2/c1-2-7-20-15(10-5-8-19-9-6-10)11-3-4-12(16)14(18)13(11)17/h3-6,8-9,15,20H,2,7H2,1H3 |
| InChIKey | HCWPYBCAMASUFN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|