C11H14F3NO — CID 62965672
N-(2-methoxyethyl)-2-(2,3,4-trifluorophenyl)ethanamine (PubChem CID 62965672) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(2,3,4-trifluorophenyl)ethanamine.
| Compound Name | N-(2-methoxyethyl)-2-(2,3,4-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 62965672 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-(2-methoxyethyl)-2-(2,3,4-trifluorophenyl)ethanamine |
| SMILES | COCCNCCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H14F3NO/c1-16-7-6-15-5-4-8-2-3-9(12)11(14)10(8)13/h2-3,15H,4-7H2,1H3 |
| InChIKey | VXFWIHBKHJKSDA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|