C18H27FN2O2 — CID 113055638
N-[2-[acetyl-[2-(2-fluorophenyl)ethyl]amino]ethyl]-2-ethylbutanamide (PubChem CID 113055638) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is N-[2-[acetyl-[2-(2-fluorophenyl)ethyl]amino]ethyl]-2-ethylbutanamide.
| Compound Name | N-[2-[acetyl-[2-(2-fluorophenyl)ethyl]amino]ethyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 113055638 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | N-[2-[acetyl-[2-(2-fluorophenyl)ethyl]amino]ethyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCCN(CCc1ccccc1F)C(C)=O |
| InChI | InChI=1S/C18H27FN2O2/c1-4-15(5-2)18(23)20-11-13-21(14(3)22)12-10-16-8-6-7-9-17(16)19/h6-9,15H,4-5,10-13H2,1-3H3,(H,20,23) |
| InChIKey | AWDOIHFRQHPJEV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |