C12H15ClFNO2 — CID 115186572
N-[(5-chloro-2-fluorophenyl)methyl]-2-(hydroxymethyl)butanamide (PubChem CID 115186572) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is N-[(5-chloro-2-fluorophenyl)methyl]-2-(hydroxymethyl)butanamide.
| Compound Name | N-[(5-chloro-2-fluorophenyl)methyl]-2-(hydroxymethyl)butanamide |
|---|---|
| PubChem CID | 115186572 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[(5-chloro-2-fluorophenyl)methyl]-2-(hydroxymethyl)butanamide |
| SMILES | CCC(CO)C(=O)NCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H15ClFNO2/c1-2-8(7-16)12(17)15-6-9-5-10(13)3-4-11(9)14/h3-5,8,16H,2,6-7H2,1H3,(H,15,17) |
| InChIKey | LIUOPMRSLJUWRE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |