C10H11ClFNOS — CID 115167873
N-[(5-chloro-2-fluorophenyl)methyl]-3-sulfanylpropanamide (PubChem CID 115167873) has the molecular formula C10H11ClFNOS and a molecular weight of 247.72 g/mol. Its IUPAC name is N-[(5-chloro-2-fluorophenyl)methyl]-3-sulfanylpropanamide.
| Compound Name | N-[(5-chloro-2-fluorophenyl)methyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 115167873 |
| Molecular Formula | C10H11ClFNOS |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | N-[(5-chloro-2-fluorophenyl)methyl]-3-sulfanylpropanamide |
| SMILES | O=C(CCS)NCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C10H11ClFNOS/c11-8-1-2-9(12)7(5-8)6-13-10(14)3-4-15/h1-2,5,15H,3-4,6H2,(H,13,14) |
| InChIKey | GGLNVUNWFFHNBF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|