C9H10ClFN2O — CID 116846232
2-(5-chloro-2-fluorophenyl)-N'-methylacetohydrazide (PubChem CID 116846232) has the molecular formula C9H10ClFN2O and a molecular weight of 216.64 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-N'-methylacetohydrazide.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 116846232 |
| Molecular Formula | C9H10ClFN2O |
| Molecular Weight | 216.64 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-N'-methylacetohydrazide |
| SMILES | CNNC(=O)Cc1cc(Cl)ccc1F |
| InChI | InChI=1S/C9H10ClFN2O/c1-12-13-9(14)5-6-4-7(10)2-3-8(6)11/h2-4,12H,5H2,1H3,(H,13,14) |
| InChIKey | LAKZARDKESKJOF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.64 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|