C14H10F3N3O — CID 113200317
6-cyclopropyl-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide (PubChem CID 113200317) has the molecular formula C14H10F3N3O and a molecular weight of 293.25 g/mol. Its IUPAC name is 6-cyclopropyl-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide.
| Compound Name | 6-cyclopropyl-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 113200317 |
| Molecular Formula | C14H10F3N3O |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 6-cyclopropyl-N-(2,3,4-trifluorophenyl)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(C2CC2)nn1 |
| InChI | InChI=1S/C14H10F3N3O/c15-8-3-4-10(13(17)12(8)16)18-14(21)11-6-5-9(19-20-11)7-1-2-7/h3-7H,1-2H2,(H,18,21) |
| InChIKey | FBVHCLVSCRMGLT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|