C19H18N4O3 — CID 109358693
6-(2-methoxyanilino)-N-(4-methoxyphenyl)pyrimidine-4-carboxamide (PubChem CID 109358693) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 6-(2-methoxyanilino)-N-(4-methoxyphenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(2-methoxyanilino)-N-(4-methoxyphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109358693 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 6-(2-methoxyanilino)-N-(4-methoxyphenyl)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(Nc3ccccc3OC)ncn2)cc1 |
| InChI | InChI=1S/C19H18N4O3/c1-25-14-9-7-13(8-10-14)22-19(24)16-11-18(21-12-20-16)23-15-5-3-4-6-17(15)26-2/h3-12H,1-2H3,(H,22,24)(H,20,21,23) |
| InChIKey | JZVZOPJGXPBWAQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |