C18H14Cl2N4O2 — CID 109358963
6-(3,5-dichloroanilino)-N-(4-methoxyphenyl)pyrimidine-4-carboxamide (PubChem CID 109358963) has the molecular formula C18H14Cl2N4O2 and a molecular weight of 389.24 g/mol. Its IUPAC name is 6-(3,5-dichloroanilino)-N-(4-methoxyphenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(3,5-dichloroanilino)-N-(4-methoxyphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109358963 |
| Molecular Formula | C18H14Cl2N4O2 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 6-(3,5-dichloroanilino)-N-(4-methoxyphenyl)pyrimidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(Nc3cc(Cl)cc(Cl)c3)ncn2)cc1 |
| InChI | InChI=1S/C18H14Cl2N4O2/c1-26-15-4-2-13(3-5-15)24-18(25)16-9-17(22-10-21-16)23-14-7-11(19)6-12(20)8-14/h2-10H,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | HWVUSCXMZNTIAI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |