C14H11ClF3NOS — CID 4219949
N-[4-chloro-3-(trifluoromethyl)phenyl]-5-ethylthiophene-2-carboxamide (PubChem CID 4219949) has the molecular formula C14H11ClF3NOS and a molecular weight of 333.76 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-5-ethylthiophene-2-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-5-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 4219949 |
| Molecular Formula | C14H11ClF3NOS |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-5-ethylthiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C14H11ClF3NOS/c1-2-9-4-6-12(21-9)13(20)19-8-3-5-11(15)10(7-8)14(16,17)18/h3-7H,2H2,1H3,(H,19,20) |
| InChIKey | UOSPKBOYEHPOSL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |