C10H12ClN5OS2 — CID 131916418
4-chloro-1-methyl-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]pyrazole-3-carboxamide (PubChem CID 131916418) has the molecular formula C10H12ClN5OS2 and a molecular weight of 317.83 g/mol. Its IUPAC name is 4-chloro-1-methyl-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]pyrazole-3-carboxamide.
| Compound Name | 4-chloro-1-methyl-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 131916418 |
| Molecular Formula | C10H12ClN5OS2 |
| Molecular Weight | 317.83 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 4-chloro-1-methyl-N-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]pyrazole-3-carboxamide |
| SMILES | Cc1nnc(SCCNC(=O)c2nn(C)cc2Cl)s1 |
| InChI | InChI=1S/C10H12ClN5OS2/c1-6-13-14-10(19-6)18-4-3-12-9(17)8-7(11)5-16(2)15-8/h5H,3-4H2,1-2H3,(H,12,17) |
| InChIKey | HLBCBNFCUVNWKE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.83 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|