C9H14ClN3O — CID 19263653
N-butan-2-yl-4-chloro-1-methylpyrazole-3-carboxamide (PubChem CID 19263653) has the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. Its IUPAC name is N-butan-2-yl-4-chloro-1-methylpyrazole-3-carboxamide.
| Compound Name | N-butan-2-yl-4-chloro-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19263653 |
| Molecular Formula | C9H14ClN3O |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-butan-2-yl-4-chloro-1-methylpyrazole-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1nn(C)cc1Cl |
| InChI | InChI=1S/C9H14ClN3O/c1-4-6(2)11-9(14)8-7(10)5-13(3)12-8/h5-6H,4H2,1-3H3,(H,11,14) |
| InChIKey | IJXILUUSCKBRDS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |